CAS 1138036-54-0 appears in our catalog under these names: (2–Chloro–3–fluorophenyl)hydrazine Hydrochloride, 2-Chloro-3-fluoro-hydrazine hydrochloride, (2-Chloro-3-fluorophenyl)hydrazine Hydrochloride, >95.0%(HPLC)(T), (2-Chloro-3-fluorophenyl)hydrazine hydrochloride 98%, (2-Chloro-3-fluorophenyl)hydrazine hydrochloride, ≥98%, ≥98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 2,5g, 0,25g, 1g, 10g, 100g.
(2-chloro-3-fluorophenyl)hydrazine;hydrochloride (CAS 1138036-54-0) is a chemical compound with the molecular formula C6H7Cl2FN2 and a molecular weight of 197.03 g/mol. IUPAC name: (2-chloro-3-fluorophenyl)hydrazine;hydrochloride. InChIKey: YYQJPDKDXVQERR-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2FN2 |
|---|---|
| Molecular weight | 197.03 g/mol |
| IUPAC name | (2-chloro-3-fluorophenyl)hydrazine;hydrochloride |
| InChIKey | YYQJPDKDXVQERR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Cl)NN.Cl |
Computed by PubChem (NCBI)