Products 1138245-21-2
CAS 1138245-21-2 appears in our catalog under these names: Mirogabalin besylate, 95%, Mirogabalin besylate (DS 5565 besylate), Mirogabalin besylate, Mirogabalin besylate 98%, (1R,5S,6S)-6-(Aminomethyl)-3-ethylbicyclo[3.2.0]hept-3-ene-6-acetic acid benzenesulfonate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg.
2-[(1R,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid;benzenesulfonic acid (CAS 1138245-21-2) is a chemical compound with the molecular formula C18H25NO5S and a molecular weight of 367.5 g/mol. IUPAC name: 2-[(1R,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid;benzenesulfonic acid. InChIKey: OKJXJRVWXYRSAN-TXULWXBWSA-N.
| Molecular formula | C18H25NO5S |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | 2-[(1R,5S,6S)-6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid;benzenesulfonic acid |
| InChIKey | OKJXJRVWXYRSAN-TXULWXBWSA-N |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@@]2(CC(=O)O)CN.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)