CAS 1138443-87-4 is the registry number for 6-((tert-Butyldimethylsilyloxy)methyl)-2,3-dimethoxypyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl-[(5,6-dimethoxy-2-pyridinyl)methoxy]-dimethylsilane (CAS 1138443-87-4) is a chemical compound with the molecular formula C14H25NO3Si and a molecular weight of 283.44 g/mol. IUPAC name: tert-butyl-[(5,6-dimethoxy-2-pyridinyl)methoxy]-dimethylsilane. InChIKey: ANUDVRIMTVJPLR-UHFFFAOYSA-N.
| Molecular formula | C14H25NO3Si |
|---|---|
| Molecular weight | 283.44 g/mol |
| IUPAC name | tert-butyl-[(5,6-dimethoxy-2-pyridinyl)methoxy]-dimethylsilane |
| InChIKey | ANUDVRIMTVJPLR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=NC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)