CAS 1138458-15-7 is the registry number for Linezolid Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-5-chloro-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one (CAS 1138458-15-7) is a chemical compound with the molecular formula C13H14ClFN2O3 and a molecular weight of 300.71 g/mol. IUPAC name: (5R)-5-chloro-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one. InChIKey: LAZHLNFHYBFBCS-LBPRGKRZSA-N.
| Molecular formula | C13H14ClFN2O3 |
|---|---|
| Molecular weight | 300.71 g/mol |
| IUPAC name | (5R)-5-chloro-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one |
| InChIKey | LAZHLNFHYBFBCS-LBPRGKRZSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)N3C[C@H](OC3=O)Cl)F |
Computed by PubChem (NCBI)