Products 1138681-69-2
CAS 1138681-69-2 is the registry number for o-Tolunitrile-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
2,3,4,5-tetradeuterio-6-(trideuteriomethyl)benzonitrile (CAS 1138681-69-2) is a chemical compound with the molecular formula C8H7N and a molecular weight of 124.19 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(trideuteriomethyl)benzonitrile. InChIKey: NWPNXBQSRGKSJB-AAYPNNLASA-N.
| Molecular formula | C8H7N |
|---|---|
| Molecular weight | 124.19 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(trideuteriomethyl)benzonitrile |
| InChIKey | NWPNXBQSRGKSJB-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C#N)C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)