CAS 113892-09-4 is the registry number for Tocopherol Impurity 60. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chromen-6-ol (CAS 113892-09-4) is a chemical compound with the molecular formula C29H48O2 and a molecular weight of 428.7 g/mol. IUPAC name: (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chromen-6-ol. InChIKey: JDRGHECKJUSWSU-IEOSBIPESA-N.
| Molecular formula | C29H48O2 |
|---|---|
| Molecular weight | 428.7 g/mol |
| IUPAC name | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]chromen-6-ol |
| InChIKey | JDRGHECKJUSWSU-IEOSBIPESA-N |
| SMILES | CC1=C(C2=C(C=C[C@@](O2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=C1O)C)C |
Computed by PubChem (NCBI)