Products 113922-55-7
CAS 113922-55-7 appears in our catalog under these names: Dehydro Trospium Chloride, Trospium Impurity 4, Dehydrotrospium Chloride. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Spiro[2,5-dihydropyrrol-1-ium-1,8'-8-azoniabicyclo[3.2.1]octane]-3'-yl 2-hydroxy-2,2-diphenylacetate chloride (CAS 113922-55-7) is a chemical compound with the molecular formula C25H28ClNO3 and a molecular weight of 425.9 g/mol. IUPAC name: spiro[2,5-dihydropyrrol-1-ium-1,8'-8-azoniabicyclo[3.2.1]octane]-3'-yl 2-hydroxy-2,2-diphenylacetate chloride. InChIKey: RWSLGLKFNITMBE-UHFFFAOYSA-M.
| Molecular formula | C25H28ClNO3 |
|---|---|
| Molecular weight | 425.9 g/mol |
| IUPAC name | spiro[2,5-dihydropyrrol-1-ium-1,8'-8-azoniabicyclo[3.2.1]octane]-3'-yl 2-hydroxy-2,2-diphenylacetate chloride |
| InChIKey | RWSLGLKFNITMBE-UHFFFAOYSA-M |
| SMILES | C1CC2CC(CC1[N+]23CC=CC3)OC(=O)C(C4=CC=CC=C4)(C5=CC=CC=C5)O.[Cl-] |
Computed by PubChem (NCBI)