Products 113949-00-1
CAS 113949-00-1 is the registry number for rac-2-((1R,2R)-2-Methyl-3-oxocyclopentyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(1R,2R)-2-methyl-3-oxocyclopentyl]acetic acid (CAS 113949-00-1) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: 2-[(1R,2R)-2-methyl-3-oxocyclopentyl]acetic acid. InChIKey: VNXRDGISGJJAAW-PHDIDXHHSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | 2-[(1R,2R)-2-methyl-3-oxocyclopentyl]acetic acid |
| InChIKey | VNXRDGISGJJAAW-PHDIDXHHSA-N |
| SMILES | C[C@@H]1[C@H](CCC1=O)CC(=O)O |
Computed by PubChem (NCBI)