CAS 113950-01-9 appears in our catalog under these names: Nicotinamide-N-15N, 98% 98%atom%15N, Nicotinamide-N-15N. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 5mg.
Pyridine-3-(15N)carboxamide (CAS 113950-01-9) is a chemical compound with the molecular formula C6H6N2O and a molecular weight of 123.12 g/mol. IUPAC name: pyridine-3-(15N)carboxamide. InChIKey: DFPAKSUCGFBDDF-CDYZYAPPSA-N.
| Molecular formula | C6H6N2O |
|---|---|
| Molecular weight | 123.12 g/mol |
| IUPAC name | pyridine-3-(15N)carboxamide |
| InChIKey | DFPAKSUCGFBDDF-CDYZYAPPSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)[15NH2] |
Computed by PubChem (NCBI)