Products 1139884-47-1
CAS 1139884-47-1 is the registry number for (9H-Fluoren-9-yl)methyl (4-(aminomethyl)phenyl)carbamate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
9H-fluoren-9-ylmethyl N-[4-(aminomethyl)phenyl]carbamate;hydrochloride (CAS 1139884-47-1) is a chemical compound with the molecular formula C22H21ClN2O2 and a molecular weight of 380.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[4-(aminomethyl)phenyl]carbamate;hydrochloride. InChIKey: XSQTWCPSSZZUPR-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN2O2 |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[4-(aminomethyl)phenyl]carbamate;hydrochloride |
| InChIKey | XSQTWCPSSZZUPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CN.Cl |
Computed by PubChem (NCBI)