CAS 114012-12-3 appears in our catalog under these names: Phaclofen, Phaclofen/ 99.32% (existing batch purity), Phaclofen, 98%, 98%, Phaclofen, 99.98%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 25 mg.
[3-amino-2-(4-chlorophenyl)propyl]phosphonic acid (CAS 114012-12-3) is a chemical compound with the molecular formula C9H13ClNO3P and a molecular weight of 249.63 g/mol. IUPAC name: [3-amino-2-(4-chlorophenyl)propyl]phosphonic acid. InChIKey: VSGNGLJPOGUDON-UHFFFAOYSA-N.
| Molecular formula | C9H13ClNO3P |
|---|---|
| Molecular weight | 249.63 g/mol |
| IUPAC name | [3-amino-2-(4-chlorophenyl)propyl]phosphonic acid |
| InChIKey | VSGNGLJPOGUDON-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CN)CP(=O)(O)O)Cl |
Computed by PubChem (NCBI)