CAS 114041-34-8 appears in our catalog under these names: Carprofen Impurity 9, 9-Acetyl-6-chloro-2-(2-chloro-1-oxopropyl)-9H-carbazole. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1-(9-acetyl-6-chlorocarbazol-2-yl)-2-chloropropan-1-one (CAS 114041-34-8) is a chemical compound with the molecular formula C17H13Cl2NO2 and a molecular weight of 334.2 g/mol. IUPAC name: 1-(9-acetyl-6-chlorocarbazol-2-yl)-2-chloropropan-1-one. InChIKey: MUUAMUZKWBQPCO-UHFFFAOYSA-N.
| Molecular formula | C17H13Cl2NO2 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 1-(9-acetyl-6-chlorocarbazol-2-yl)-2-chloropropan-1-one |
| InChIKey | MUUAMUZKWBQPCO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC2=C(C=C1)C3=C(N2C(=O)C)C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)