CAS 1140900-07-7 is the registry number for (2-fluoro-5-methoxyphenyl)(thiophen-2-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2-fluoro-5-methoxyphenyl)-thiophen-2-ylmethanol (CAS 1140900-07-7) is a chemical compound with the molecular formula C12H11FO2S and a molecular weight of 238.28 g/mol. IUPAC name: (2-fluoro-5-methoxyphenyl)-thiophen-2-ylmethanol. InChIKey: KIHSFOJYDVAZOK-UHFFFAOYSA-N.
| Molecular formula | C12H11FO2S |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (2-fluoro-5-methoxyphenyl)-thiophen-2-ylmethanol |
| InChIKey | KIHSFOJYDVAZOK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)F)C(C2=CC=CS2)O |
Computed by PubChem (NCBI)