Products 114121-68-5
CAS 114121-68-5 is the registry number for Penehyclidine Impurity 9 ((R,R)-Penehyclidine). Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopentyl-1-phenylethanol (CAS 114121-68-5) is a chemical compound with the molecular formula C20H29NO2 and a molecular weight of 315.4 g/mol. IUPAC name: (1R)-2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopentyl-1-phenylethanol. InChIKey: GTKRIWMDLNOSLI-PMACEKPBSA-N.
| Molecular formula | C20H29NO2 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | (1R)-2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-1-cyclopentyl-1-phenylethanol |
| InChIKey | GTKRIWMDLNOSLI-PMACEKPBSA-N |
| SMILES | C1CCC(C1)[C@](CO[C@H]2CN3CCC2CC3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)