CAS 1141479-01-7 is the registry number for (R)-2-Hydroxy-3-(1H-imidazol-5-yl)propanoic acid 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-hydroxy-3-(1H-imidazol-5-yl)propanoic acid (CAS 1141479-01-7) is a chemical compound with the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. IUPAC name: (2R)-2-hydroxy-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: ACZFBYCNAVEFLC-RXMQYKEDSA-N.
| Molecular formula | C6H8N2O3 |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | (2R)-2-hydroxy-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | ACZFBYCNAVEFLC-RXMQYKEDSA-N |
| SMILES | C1=C(NC=N1)C[C@H](C(=O)O)O |
Computed by PubChem (NCBI)