CAS 114153-36-5 is the registry number for N-(3-Chloro-2-methylphenyl)-2,2-dimethylpropanamide. Offered by: TRC. Available pack sizes: 5g.
N-(3-chloro-2-methylphenyl)-2,2-dimethylpropanamide (CAS 114153-36-5) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: N-(3-chloro-2-methylphenyl)-2,2-dimethylpropanamide. InChIKey: YQVJHVGXBACZLU-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | N-(3-chloro-2-methylphenyl)-2,2-dimethylpropanamide |
| InChIKey | YQVJHVGXBACZLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)