CAS 114163-48-3 is the registry number for 7-Phenyl-3H,4H,7H-pyrazolo(3,4-d)(1,2,3)triazin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-phenyl-3H-pyrazolo[5,4-d]triazin-4-one (CAS 114163-48-3) is a chemical compound with the molecular formula C10H7N5O and a molecular weight of 213.20 g/mol. IUPAC name: 7-phenyl-3H-pyrazolo[5,4-d]triazin-4-one. InChIKey: ODBQOGDBWHQVKL-UHFFFAOYSA-N.
| Molecular formula | C10H7N5O |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 7-phenyl-3H-pyrazolo[5,4-d]triazin-4-one |
| InChIKey | ODBQOGDBWHQVKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=N2)C(=O)NN=N3 |
Computed by PubChem (NCBI)