Products 114171-36-7
CAS 114171-36-7 is the registry number for (4-Chloro-phenyl)-(2-morpholin-4-yl-4-phenyl-thiazol-5-yl)-methanone, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(4-chlorophenyl)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methanone (CAS 114171-36-7) is a chemical compound with the molecular formula C20H17ClN2O2S and a molecular weight of 384.9 g/mol. IUPAC name: (4-chlorophenyl)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methanone. InChIKey: GOULPRZWJPNJJU-UHFFFAOYSA-N.
| Molecular formula | C20H17ClN2O2S |
|---|---|
| Molecular weight | 384.9 g/mol |
| IUPAC name | (4-chlorophenyl)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methanone |
| InChIKey | GOULPRZWJPNJJU-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=C(S2)C(=O)C3=CC=C(C=C3)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)