CAS 1141928-29-1 is the registry number for L-Carnitine tartrate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;2,3,4,4-tetrahydroxybutanoic acid (CAS 1141928-29-1) is a chemical compound with the molecular formula C11H23NO9 and a molecular weight of 313.30 g/mol. IUPAC name: (3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;2,3,4,4-tetrahydroxybutanoic acid. InChIKey: KCSRITPMKZWOGA-FYZOBXCZSA-N.
| Molecular formula | C11H23NO9 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | (3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;2,3,4,4-tetrahydroxybutanoic acid |
| InChIKey | KCSRITPMKZWOGA-FYZOBXCZSA-N |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])O.C(C(C(=O)O)O)(C(O)O)O |
Computed by PubChem (NCBI)