Products 1141928-29-1

CAS 1141928-29-1 is the registry number for L-Carnitine tartrate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;2,3,4,4-tetrahydroxybutanoic acid (CAS 1141928-29-1) is a chemical compound with the molecular formula C11H23NO9 and a molecular weight of 313.30 g/mol. IUPAC name: (3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;2,3,4,4-tetrahydroxybutanoic acid. InChIKey: KCSRITPMKZWOGA-FYZOBXCZSA-N.

Identity
Molecular formulaC11H23NO9
Molecular weight313.30 g/mol
IUPAC name(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate;2,3,4,4-tetrahydroxybutanoic acid
InChIKeyKCSRITPMKZWOGA-FYZOBXCZSA-N
SMILESC[N+](C)(C)C[C@@H](CC(=O)[O-])O.C(C(C(=O)O)O)(C(O)O)O

Computed by PubChem (NCBI)