CAS 1141934-97-5 appears in our catalog under these names: Emixustat hydrochloride, 95%, Emixustat hydrochloride/ 99.48% (existing batch purity), Emixustat HCl 98+%, (1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol hydrochloride, 98+%, 98+%, Emixustat (hydrochloride), 99.29%. Offered by: Combi-blocks, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 5 mg.
(1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol;hydrochloride (CAS 1141934-97-5) is a chemical compound with the molecular formula C16H26ClNO2 and a molecular weight of 299.83 g/mol. IUPAC name: (1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol;hydrochloride. InChIKey: BPZWRYOUJMDQSY-PKLMIRHRSA-N.
| Molecular formula | C16H26ClNO2 |
|---|---|
| Molecular weight | 299.83 g/mol |
| IUPAC name | (1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol;hydrochloride |
| InChIKey | BPZWRYOUJMDQSY-PKLMIRHRSA-N |
| SMILES | C1CCC(CC1)COC2=CC=CC(=C2)[C@@H](CCN)O.Cl |
Computed by PubChem (NCBI)