Products 1142096-13-6
CAS 1142096-13-6 appears in our catalog under these names: 4-Bromo-2,6-dimethylphenol-d8 (Major), >95% (HPLC), 4-Bromo-2,6-dimethylphenol-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 100 mg, 25 mg, 10 mg, 50 mg.
4-bromo-3,5-dideuterio-2,6-bis(trideuteriomethyl)phenol (CAS 1142096-13-6) is a chemical compound with the molecular formula C8H9BrO and a molecular weight of 209.11 g/mol. IUPAC name: 4-bromo-3,5-dideuterio-2,6-bis(trideuteriomethyl)phenol. InChIKey: ZLVFYUORUHNMBO-PIODKIDGSA-N.
| Molecular formula | C8H9BrO |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | 4-bromo-3,5-dideuterio-2,6-bis(trideuteriomethyl)phenol |
| InChIKey | ZLVFYUORUHNMBO-PIODKIDGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Br)[2H])C([2H])([2H])[2H])O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)