Products 1142096-16-9
CAS 1142096-16-9 is the registry number for 3,5-Dimethyl-4-hydroxybenzonitrile-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
2,6-dideuterio-4-hydroxy-3,5-bis(trideuteriomethyl)benzonitrile (CAS 1142096-16-9) is a chemical compound with the molecular formula C9H9NO and a molecular weight of 155.22 g/mol. IUPAC name: 2,6-dideuterio-4-hydroxy-3,5-bis(trideuteriomethyl)benzonitrile. InChIKey: WFYGXOWFEIOHCZ-PIODKIDGSA-N.
| Molecular formula | C9H9NO |
|---|---|
| Molecular weight | 155.22 g/mol |
| IUPAC name | 2,6-dideuterio-4-hydroxy-3,5-bis(trideuteriomethyl)benzonitrile |
| InChIKey | WFYGXOWFEIOHCZ-PIODKIDGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])O)C([2H])([2H])[2H])[2H])C#N |
Computed by PubChem (NCBI)