Products 1142192-37-7

CAS 1142192-37-7 is the registry number for 2-Bromo-5-iodopyridin-3-yl tert-butyl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(2-bromo-5-iodo-3-pyridinyl) tert-butyl carbonate (CAS 1142192-37-7) is a chemical compound with the molecular formula C10H11BrINO3 and a molecular weight of 400.01 g/mol. IUPAC name: (2-bromo-5-iodo-3-pyridinyl) tert-butyl carbonate. InChIKey: WRKKGHFAKXJOJK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrINO3
Molecular weight400.01 g/mol
IUPAC name(2-bromo-5-iodo-3-pyridinyl) tert-butyl carbonate
InChIKeyWRKKGHFAKXJOJK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)OC1=C(N=CC(=C1)I)Br

Computed by PubChem (NCBI)