CAS 1142192-37-7 is the registry number for 2-Bromo-5-iodopyridin-3-yl tert-butyl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-bromo-5-iodo-3-pyridinyl) tert-butyl carbonate (CAS 1142192-37-7) is a chemical compound with the molecular formula C10H11BrINO3 and a molecular weight of 400.01 g/mol. IUPAC name: (2-bromo-5-iodo-3-pyridinyl) tert-butyl carbonate. InChIKey: WRKKGHFAKXJOJK-UHFFFAOYSA-N.
| Molecular formula | C10H11BrINO3 |
|---|---|
| Molecular weight | 400.01 g/mol |
| IUPAC name | (2-bromo-5-iodo-3-pyridinyl) tert-butyl carbonate |
| InChIKey | WRKKGHFAKXJOJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=C(N=CC(=C1)I)Br |
Computed by PubChem (NCBI)