Products 1142199-56-1
CAS 1142199-56-1 is the registry number for (4E)-3-(Chloromethyl)-4-(1h-indol-3-ylmethylene)isoxazol-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-(chloromethyl)-4-[(Z)-indol-3-ylidenemethyl]-2H-1,2-oxazol-5-one (CAS 1142199-56-1) is a chemical compound with the molecular formula C13H9ClN2O2 and a molecular weight of 260.67 g/mol. IUPAC name: 3-(chloromethyl)-4-[(Z)-indol-3-ylidenemethyl]-2H-1,2-oxazol-5-one. InChIKey: QFPDGAJIDNMIOW-VMPITWQZSA-N.
| Molecular formula | C13H9ClN2O2 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | 3-(chloromethyl)-4-[(Z)-indol-3-ylidenemethyl]-2H-1,2-oxazol-5-one |
| InChIKey | QFPDGAJIDNMIOW-VMPITWQZSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=C(NOC3=O)CCl)/C=N2 |
Computed by PubChem (NCBI)