Products 1142202-54-7
CAS 1142202-54-7 is the registry number for 5-Oxo-1-(1,1,3,3-tetramethylbutyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxylic acid (CAS 1142202-54-7) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: 5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxylic acid. InChIKey: ADEBQTLEBIFKRN-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | 5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidine-3-carboxylic acid |
| InChIKey | ADEBQTLEBIFKRN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)N1CC(CC1=O)C(=O)O |
Computed by PubChem (NCBI)