CAS 1142202-72-9 appears in our catalog under these names: 3-(5-([(2-Fluorophenyl)amino]carbonyl)-1,3,4-thiadiazol-2-yl)propanoic acid, 95%, 3-(5-((2-Fluorophenyl)carbamoyl)-1,3,4-thiadiazol-2-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-[5-[(2-fluorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]propanoic acid (CAS 1142202-72-9) is a chemical compound with the molecular formula C12H10FN3O3S and a molecular weight of 295.29 g/mol. IUPAC name: 3-[5-[(2-fluorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]propanoic acid. InChIKey: HWFNZIFXIBXUQY-UHFFFAOYSA-N.
| Molecular formula | C12H10FN3O3S |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 3-[5-[(2-fluorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]propanoic acid |
| InChIKey | HWFNZIFXIBXUQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C2=NN=C(S2)CCC(=O)O)F |
Computed by PubChem (NCBI)