CAS 1142202-89-8 is the registry number for 4-(5-([(3-Fluorophenyl)amino]carbonyl)-1,3,4-thiadiazol-2-yl)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[5-[(3-fluorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]butanoic acid (CAS 1142202-89-8) is a chemical compound with the molecular formula C13H12FN3O3S and a molecular weight of 309.32 g/mol. IUPAC name: 4-[5-[(3-fluorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]butanoic acid. InChIKey: KJDVLIBDLUMZFR-UHFFFAOYSA-N.
| Molecular formula | C13H12FN3O3S |
|---|---|
| Molecular weight | 309.32 g/mol |
| IUPAC name | 4-[5-[(3-fluorophenyl)carbamoyl]-1,3,4-thiadiazol-2-yl]butanoic acid |
| InChIKey | KJDVLIBDLUMZFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)NC(=O)C2=NN=C(S2)CCCC(=O)O |
Computed by PubChem (NCBI)