CAS 1142210-12-5 appears in our catalog under these names: 4-(([5-(2-Fluorobenzyl)-1,3,4-thiadiazol-2-yl]carbonyl)amino)benzoic acid, 95%, 4-(5-(2-Fluorobenzyl)-1,3,4-thiadiazole-2-carboxamido)benzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-[[5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carbonyl]amino]benzoic acid (CAS 1142210-12-5) is a chemical compound with the molecular formula C17H12FN3O3S and a molecular weight of 357.4 g/mol. IUPAC name: 4-[[5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carbonyl]amino]benzoic acid. InChIKey: YQLOZALSUFLDES-UHFFFAOYSA-N.
| Molecular formula | C17H12FN3O3S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-[[5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carbonyl]amino]benzoic acid |
| InChIKey | YQLOZALSUFLDES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NN=C(S2)C(=O)NC3=CC=C(C=C3)C(=O)O)F |
Computed by PubChem (NCBI)