CAS 1142409-65-1 is the registry number for 2-Methyl-1,4-naphthalenediol-d8. Offered by: TRC. Available pack sizes: 10mg, 1mg.
2,5,6,7,8-pentadeuterio-3-(trideuteriomethyl)naphthalene-1,4-diol (CAS 1142409-65-1) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 182.24 g/mol. IUPAC name: 2,5,6,7,8-pentadeuterio-3-(trideuteriomethyl)naphthalene-1,4-diol. InChIKey: ZJTLZYDQJHKRMQ-JGUCLWPXSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 182.24 g/mol |
| IUPAC name | 2,5,6,7,8-pentadeuterio-3-(trideuteriomethyl)naphthalene-1,4-diol |
| InChIKey | ZJTLZYDQJHKRMQ-JGUCLWPXSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2O)C([2H])([2H])[2H])[2H])O)[2H])[2H] |
Computed by PubChem (NCBI)