Products 1143514-73-1
CAS 1143514-73-1 is the registry number for (Z)-4-(4-(dimethylamino)styryl)-1-methylpyridin-1-ium iodide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
N,N-dimethyl-4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;iodide (CAS 1143514-73-1) is a chemical compound with the molecular formula C16H19IN2 and a molecular weight of 366.24 g/mol. IUPAC name: N,N-dimethyl-4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;iodide. InChIKey: UJNFDSOJKNOBIA-UHFFFAOYSA-M.
| Molecular formula | C16H19IN2 |
|---|---|
| Molecular weight | 366.24 g/mol |
| IUPAC name | N,N-dimethyl-4-[(Z)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;iodide |
| InChIKey | UJNFDSOJKNOBIA-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=C(C=C1)/C=C\C2=CC=C(C=C2)N(C)C.[I-] |
Computed by PubChem (NCBI)