CAS 1144-36-1 appears in our catalog under these names: 4,4-Dibromo-2,6-di-tert-butylcyclohexa-2,5-dienone, 95%, 95%, 4,4-Dibromo-2,6-di-tert-butylcyclohexa-2,5-dienone, 97%, 4,4-Dibromo-2,6-di-tert-butylcyclohexa-2,5-dienone, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 10g.
4,4-dibromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one (CAS 1144-36-1) is a chemical compound with the molecular formula C14H20Br2O and a molecular weight of 364.12 g/mol. IUPAC name: 4,4-dibromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one. InChIKey: WRRFKBTXZIRGSF-UHFFFAOYSA-N.
| Molecular formula | C14H20Br2O |
|---|---|
| Molecular weight | 364.12 g/mol |
| IUPAC name | 4,4-dibromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
| InChIKey | WRRFKBTXZIRGSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(C=C(C1=O)C(C)(C)C)(Br)Br |
Computed by PubChem (NCBI)