CAS 1144035-53-9 appears in our catalog under these names: PF8380, PF–8380, PF-8380/ 99.45% (existing batch purity), PF 8380, PF-8380 99%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 250mg, 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 50mg, 25mg, 200mg.
(3,5-dichlorophenyl)methyl 4-[3-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)propyl]piperazine-1-carboxylate (CAS 1144035-53-9) is a chemical compound with the molecular formula C22H21Cl2N3O5 and a molecular weight of 478.3 g/mol. IUPAC name: (3,5-dichlorophenyl)methyl 4-[3-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)propyl]piperazine-1-carboxylate. InChIKey: JMSUDQYHPSNBSN-UHFFFAOYSA-N.
| Molecular formula | C22H21Cl2N3O5 |
|---|---|
| Molecular weight | 478.3 g/mol |
| IUPAC name | (3,5-dichlorophenyl)methyl 4-[3-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)propyl]piperazine-1-carboxylate |
| InChIKey | JMSUDQYHPSNBSN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCC(=O)C2=CC3=C(C=C2)NC(=O)O3)C(=O)OCC4=CC(=CC(=C4)Cl)Cl |
Computed by PubChem (NCBI)