CAS 1144080-31-8 is the registry number for 4,6-Dichloro-1-(1,4-dioxaspiro(4.5)decan-8-yl)-1h-pyrazolo(3,4-d)pyrimidine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4,6-dichloro-1-(1,4-dioxaspiro[4.5]decan-8-yl)pyrazolo[5,4-d]pyrimidine (CAS 1144080-31-8) is a chemical compound with the molecular formula C13H14Cl2N4O2 and a molecular weight of 329.18 g/mol. IUPAC name: 4,6-dichloro-1-(1,4-dioxaspiro[4.5]decan-8-yl)pyrazolo[5,4-d]pyrimidine. InChIKey: NBPHZZVDIJRLQC-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N4O2 |
|---|---|
| Molecular weight | 329.18 g/mol |
| IUPAC name | 4,6-dichloro-1-(1,4-dioxaspiro[4.5]decan-8-yl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | NBPHZZVDIJRLQC-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1N3C4=C(C=N3)C(=NC(=N4)Cl)Cl)OCCO2 |
Computed by PubChem (NCBI)