CAS 1144099-54-6 is the registry number for Ethyl rac-(1r,5s,6s)-3-azabicyclo[3.1.0]hexane-6-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Ethyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate (CAS 1144099-54-6) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: ethyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate. InChIKey: LLYQBDZAXNIXQC-MEKDEQNOSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | ethyl (1S,5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| InChIKey | LLYQBDZAXNIXQC-MEKDEQNOSA-N |
| SMILES | CCOC(=O)C1[C@H]2[C@@H]1CNC2 |
Computed by PubChem (NCBI)