Products 1144449-18-2
CAS 1144449-18-2 is the registry number for 7-chloro-2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidine (CAS 1144449-18-2) is a chemical compound with the molecular formula C14H12ClN3 and a molecular weight of 257.72 g/mol. IUPAC name: 7-chloro-2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidine. InChIKey: JOISBKFSEWNWGJ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3 |
|---|---|
| Molecular weight | 257.72 g/mol |
| IUPAC name | 7-chloro-2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidine |
| InChIKey | JOISBKFSEWNWGJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=NN2C(=C1)Cl)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)