CAS 1144501-45-0 is the registry number for (R)-2,2-dimethylchroman-4-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4R)-2,2-dimethyl-3,4-dihydrochromen-4-amine (CAS 1144501-45-0) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: (4R)-2,2-dimethyl-3,4-dihydrochromen-4-amine. InChIKey: YSTIIIRGSQEQNH-SECBINFHSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | (4R)-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| InChIKey | YSTIIIRGSQEQNH-SECBINFHSA-N |
| SMILES | CC1(C[C@H](C2=CC=CC=C2O1)N)C |
Computed by PubChem (NCBI)