CAS 1144519-73-2 appears in our catalog under these names: (2R,6S)-2,6-Dimethyl-4-(piperidin-4-yl)morpholine, 95%, (2R,6S)-2,6-Dimethyl-4-(piperidin-4-yl)morpholine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2g, 25g.
(2S,6R)-2,6-dimethyl-4-piperidin-4-ylmorpholine (CAS 1144519-73-2) is a chemical compound with the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. IUPAC name: (2S,6R)-2,6-dimethyl-4-piperidin-4-ylmorpholine. InChIKey: MYYJFAYHVMWIDI-AOOOYVTPSA-N.
| Molecular formula | C11H22N2O |
|---|---|
| Molecular weight | 198.31 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethyl-4-piperidin-4-ylmorpholine |
| InChIKey | MYYJFAYHVMWIDI-AOOOYVTPSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C2CCNCC2 |
Computed by PubChem (NCBI)