CAS 114460-02-5 is the registry number for Bis(ethylcyclopentadienyl)magnesium. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Magnesium bis(2-ethylcyclopenta-1,3-diene) (CAS 114460-02-5) is a chemical compound with the molecular formula C14H18Mg and a molecular weight of 210.60 g/mol. IUPAC name: magnesium bis(2-ethylcyclopenta-1,3-diene). InChIKey: UBRLRTCDAHALGT-UHFFFAOYSA-N.
| Molecular formula | C14H18Mg |
|---|---|
| Molecular weight | 210.60 g/mol |
| IUPAC name | magnesium bis(2-ethylcyclopenta-1,3-diene) |
| InChIKey | UBRLRTCDAHALGT-UHFFFAOYSA-N |
| SMILES | CCC1=[C-]CC=C1.CCC1=[C-]CC=C1.[Mg+2] |
Computed by PubChem (NCBI)