CAS 114544-81-9 is the registry number for Bromuconazole LS 850647, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
1-[[(2S,4S)-4-bromo-2-(2,4-dichlorophenyl)oxolan-2-yl]methyl]-1,2,4-triazole (CAS 114544-81-9) is a chemical compound with the molecular formula C13H12BrCl2N3O and a molecular weight of 377.1 g/mol. IUPAC name: 1-[[(2S,4S)-4-bromo-2-(2,4-dichlorophenyl)oxolan-2-yl]methyl]-1,2,4-triazole. InChIKey: HJJVPARKXDDIQD-TVQRCGJNSA-N.
| Molecular formula | C13H12BrCl2N3O |
|---|---|
| Molecular weight | 377.1 g/mol |
| IUPAC name | 1-[[(2S,4S)-4-bromo-2-(2,4-dichlorophenyl)oxolan-2-yl]methyl]-1,2,4-triazole |
| InChIKey | HJJVPARKXDDIQD-TVQRCGJNSA-N |
| SMILES | C1[C@@H](CO[C@]1(CN2C=NC=N2)C3=C(C=C(C=C3)Cl)Cl)Br |
Computed by PubChem (NCBI)