CAS 114567-98-5 is the registry number for 3,3',3''-((1,3,5-Triazine-2,4,6-triyl)tris(oxy))tribenzaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[4,6-bis(3-formylphenoxy)-1,3,5-triazin-2-yl]oxy]benzaldehyde (CAS 114567-98-5) is a chemical compound with the molecular formula C24H15N3O6 and a molecular weight of 441.4 g/mol. IUPAC name: 3-[[4,6-bis(3-formylphenoxy)-1,3,5-triazin-2-yl]oxy]benzaldehyde. InChIKey: YECALBKGKDLPBR-UHFFFAOYSA-N.
| Molecular formula | C24H15N3O6 |
|---|---|
| Molecular weight | 441.4 g/mol |
| IUPAC name | 3-[[4,6-bis(3-formylphenoxy)-1,3,5-triazin-2-yl]oxy]benzaldehyde |
| InChIKey | YECALBKGKDLPBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NC(=NC(=N2)OC3=CC=CC(=C3)C=O)OC4=CC=CC(=C4)C=O)C=O |
Computed by PubChem (NCBI)