CAS 114606-56-3 appears in our catalog under these names: SDZ-MKS 492, 99+%, SDZ–MKS 492, SDZ-MKS 492, SDZ-MKS 492, 98.07%, 98.07%, SDZ-MKS 492, 99.77%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg, 1mg, 100 mg.
8-[[(1R)-1-(3,4-dimethoxyphenyl)-2-hydroxyethyl]amino]-7-(2-methoxyethyl)-1,3-dimethylpurine-2,6-dione (CAS 114606-56-3) is a chemical compound with the molecular formula C20H27N5O6 and a molecular weight of 433.5 g/mol. IUPAC name: 8-[[(1R)-1-(3,4-dimethoxyphenyl)-2-hydroxyethyl]amino]-7-(2-methoxyethyl)-1,3-dimethylpurine-2,6-dione. InChIKey: VZLFAVFWNOZVFM-ZDUSSCGKSA-N.
| Molecular formula | C20H27N5O6 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | 8-[[(1R)-1-(3,4-dimethoxyphenyl)-2-hydroxyethyl]amino]-7-(2-methoxyethyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | VZLFAVFWNOZVFM-ZDUSSCGKSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C(=N2)N[C@@H](CO)C3=CC(=C(C=C3)OC)OC)CCOC |
Computed by PubChem (NCBI)