Products 1146210-64-1

CAS 1146210-64-1 is the registry number for S-Methyl 2,5-difluorobenzothioate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

S-methyl 2,5-difluorobenzenecarbothioate (CAS 1146210-64-1) is a chemical compound with the molecular formula C8H6F2OS and a molecular weight of 188.20 g/mol. IUPAC name: S-methyl 2,5-difluorobenzenecarbothioate. InChIKey: WGOMOILVAWKEGF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2OS
Molecular weight188.20 g/mol
IUPAC nameS-methyl 2,5-difluorobenzenecarbothioate
InChIKeyWGOMOILVAWKEGF-UHFFFAOYSA-N
SMILESCSC(=O)C1=C(C=CC(=C1)F)F

Computed by PubChem (NCBI)