Products 1146299-24-2
CAS 1146299-24-2 is the registry number for 2-(1H-1,2,3,4-Tetrazol-1-yl)-4H,5H,6H-cyclopenta(b)thiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-(tetrazol-1-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid (CAS 1146299-24-2) is a chemical compound with the molecular formula C9H8N4O2S and a molecular weight of 236.25 g/mol. IUPAC name: 2-(tetrazol-1-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid. InChIKey: RBUWLBYPDYPHID-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2S |
|---|---|
| Molecular weight | 236.25 g/mol |
| IUPAC name | 2-(tetrazol-1-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
| InChIKey | RBUWLBYPDYPHID-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)O)N3C=NN=N3 |
Computed by PubChem (NCBI)