Products 114645-18-0
CAS 114645-18-0 is the registry number for Boc-L-Tyr(Bzl)-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
Tert-butyl N-[(2S)-4-diazo-3-oxo-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate (CAS 114645-18-0) is a chemical compound with the molecular formula C22H25N3O4 and a molecular weight of 395.5 g/mol. IUPAC name: tert-butyl N-[(2S)-4-diazo-3-oxo-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate. InChIKey: LCJFXSXAVBSADP-IBGZPJMESA-N.
| Molecular formula | C22H25N3O4 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-diazo-3-oxo-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
| InChIKey | LCJFXSXAVBSADP-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)