CAS 1146594-85-5 appears in our catalog under these names: (R)-JNJ-40418677, 99.67%, (R)-JNJ-40418677 (Standard). Offered by: MedChemExpress. Available pack sizes: 50 mg, 5 mg, 100 mg, 10mM/1mL, 25 mg, 10 mg, 1 mg.
(2R)-2-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid (CAS 1146594-85-5) is a chemical compound with the molecular formula C26H22F6O2 and a molecular weight of 480.4 g/mol. IUPAC name: (2R)-2-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid. InChIKey: RQOWDDLKGBMJFX-HSZRJFAPSA-N.
| Molecular formula | C26H22F6O2 |
|---|---|
| Molecular weight | 480.4 g/mol |
| IUPAC name | (2R)-2-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
| InChIKey | RQOWDDLKGBMJFX-HSZRJFAPSA-N |
| SMILES | CC(C)C[C@H](C1=CC(=CC(=C1)C2=CC=C(C=C2)C(F)(F)F)C3=CC=C(C=C3)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)