CAS 1146697-82-6 is the registry number for 2,6-difluoro-7H-purine. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-difluoro-7H-purine (CAS 1146697-82-6) is a chemical compound with the molecular formula C5H2F2N4 and a molecular weight of 156.09 g/mol. IUPAC name: 2,6-difluoro-7H-purine. InChIKey: CVDGCLGCVLHJMP-UHFFFAOYSA-N.
| Molecular formula | C5H2F2N4 |
|---|---|
| Molecular weight | 156.09 g/mol |
| IUPAC name | 2,6-difluoro-7H-purine |
| InChIKey | CVDGCLGCVLHJMP-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)F)F |
Computed by PubChem (NCBI)