CAS 1146977-93-6 appears in our catalog under these names: Atorvastatin EP Impurity M (Atorvastatin Ethyl Ester), Atorvastatin Impurity 4(Atorvastatin EP Impurity M), Atorvastatin Ethyl Ester, >95% (HPLC), Atorvastatin Ethyl Ester, Atorvastatin ethyl ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
Ethyl (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate (CAS 1146977-93-6) is a chemical compound with the molecular formula C35H39FN2O5 and a molecular weight of 586.7 g/mol. IUPAC name: ethyl (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate. InChIKey: CXXBPVDOSCOVJU-FQLXRVMXSA-N.
| Molecular formula | C35H39FN2O5 |
|---|---|
| Molecular weight | 586.7 g/mol |
| IUPAC name | ethyl (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate |
| InChIKey | CXXBPVDOSCOVJU-FQLXRVMXSA-N |
| SMILES | CCOC(=O)C[C@@H](C[C@@H](CCN1C(=C(C(=C1C(C)C)C(=O)NC2=CC=CC=C2)C3=CC=CC=C3)C4=CC=C(C=C4)F)O)O |
Computed by PubChem (NCBI)