CAS 1147093-21-7 is the registry number for 2-(2,5-Dimethoxyphenylthio)-5-nitrobenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
2-(2,5-dimethoxyphenyl)sulfanyl-5-nitrobenzaldehyde (CAS 1147093-21-7) is a chemical compound with the molecular formula C15H13NO5S and a molecular weight of 319.3 g/mol. IUPAC name: 2-(2,5-dimethoxyphenyl)sulfanyl-5-nitrobenzaldehyde. InChIKey: BOQDRLQTTIBYHK-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5S |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 2-(2,5-dimethoxyphenyl)sulfanyl-5-nitrobenzaldehyde |
| InChIKey | BOQDRLQTTIBYHK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)SC2=C(C=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)