CAS 1147299-71-5 is the registry number for Safinamide d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2S)-3,3,3-trideuterio-2-[[4-[(3-fluorocyclohexyl)methoxy]cyclohexyl]methylamino]propanamide (CAS 1147299-71-5) is a chemical compound with the molecular formula C17H31FN2O2 and a molecular weight of 317.5 g/mol. IUPAC name: (2S)-3,3,3-trideuterio-2-[[4-[(3-fluorocyclohexyl)methoxy]cyclohexyl]methylamino]propanamide. InChIKey: BUWOTFXAKODHPV-FCMZDJCCSA-N.
| Molecular formula | C17H31FN2O2 |
|---|---|
| Molecular weight | 317.5 g/mol |
| IUPAC name | (2S)-3,3,3-trideuterio-2-[[4-[(3-fluorocyclohexyl)methoxy]cyclohexyl]methylamino]propanamide |
| InChIKey | BUWOTFXAKODHPV-FCMZDJCCSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](C(=O)N)NCC1CCC(CC1)OCC2CCCC(C2)F |
Computed by PubChem (NCBI)