Products 1147327-26-1
CAS 1147327-26-1 is the registry number for (5-Bromo-thiophen-3-yl)-piperidin-1-yl-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(5-bromothiophen-3-yl)-piperidin-1-ylmethanone (CAS 1147327-26-1) is a chemical compound with the molecular formula C10H12BrNOS and a molecular weight of 274.18 g/mol. IUPAC name: (5-bromothiophen-3-yl)-piperidin-1-ylmethanone. InChIKey: LSPNXYSIVQVWTH-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNOS |
|---|---|
| Molecular weight | 274.18 g/mol |
| IUPAC name | (5-bromothiophen-3-yl)-piperidin-1-ylmethanone |
| InChIKey | LSPNXYSIVQVWTH-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CSC(=C2)Br |
Computed by PubChem (NCBI)